C20H42NO7P — CID 5283532
azanium [(2R)-3-[(Z)-heptadec-9-enoyl]oxy-2-hydroxypropyl] hydrogen phosphate (PubChem CID 5283532) has the molecular formula C20H42NO7P and a molecular weight of 439.53 g/mol. Its IUPAC name is azanium [(2R)-3-[(Z)-heptadec-9-enoyl]oxy-2-hydroxypropyl] hydrogen phosphate.
| Compound Name | azanium [(2R)-3-[(Z)-heptadec-9-enoyl]oxy-2-hydroxypropyl] hydrogen phosphate |
|---|---|
| PubChem CID | 5283532 |
| Molecular Formula | C20H42NO7P |
| Molecular Weight | 439.53 g/mol |
| Exact Mass | 439.27 |
| IUPAC Name | azanium [(2R)-3-[(Z)-heptadec-9-enoyl]oxy-2-hydroxypropyl] hydrogen phosphate |
| SMILES | CCCCCCC/C=C\CCCCCCCC(=O)OC[C@@H](O)COP(=O)([O-])O.[NH4+] |
| InChI | InChI=1S/C20H39O7P.H3N/c1-2-3-4-5-6-7-8-9-10-11-12-13-14-15-16-20(22)26-17-19(21)18-27-28(23,24)25;/h8-9,19,21H,2-7,10-18H2,1H3,(H2,23,24,25);1H3/b9-8-;/t19-;/m1./s1 |
| InChIKey | NUOASUMPYUGZAI-FZMGIHSNSA-N |
| XLogP | 4.39 |
| TPSA | 152.62 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 19 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 439.53 |
| LogP ≤ 5 | 4.39 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|