C24H47O7P — CID 138150720
(2-hydroxy-3-phosphonooxypropyl) (Z)-henicos-11-enoate (PubChem CID 138150720) has the molecular formula C24H47O7P and a molecular weight of 478.61 g/mol. Its IUPAC name is (2-hydroxy-3-phosphonooxypropyl) (Z)-henicos-11-enoate.
| Compound Name | (2-hydroxy-3-phosphonooxypropyl) (Z)-henicos-11-enoate |
|---|---|
| PubChem CID | 138150720 |
| Molecular Formula | C24H47O7P |
| Molecular Weight | 478.61 g/mol |
| Exact Mass | 478.31 |
| IUPAC Name | (2-hydroxy-3-phosphonooxypropyl) (Z)-henicos-11-enoate |
| SMILES | CCCCCCCCC/C=C\CCCCCCCCCC(=O)OCC(O)COP(=O)(O)O |
| InChI | InChI=1S/C24H47O7P/c1-2-3-4-5-6-7-8-9-10-11-12-13-14-15-16-17-18-19-20-24(26)30-21-23(25)22-31-32(27,28)29/h10-11,23,25H,2-9,12-22H2,1H3,(H2,27,28,29)/b11-10- |
| InChIKey | FEELSAATTLTEKN-KHPPLWFESA-N |
| XLogP | 6.21 |
| TPSA | 113.29 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 23 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 478.61 |
| LogP ≤ 5 | 6.21 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|