C21H39NaO7P — CID 171042956
1-Linoleoyl-2-hydroxy-sn-glycero-3-PA (sodium salt) (PubChem CID 171042956) has the molecular formula C21H39NaO7P and a molecular weight of 457.50 g/mol.
| Compound Name | 1-Linoleoyl-2-hydroxy-sn-glycero-3-PA (sodium salt) |
|---|---|
| PubChem CID | 171042956 |
| Molecular Formula | C21H39NaO7P |
| Molecular Weight | 457.50 g/mol |
| Exact Mass | 457.23 |
| IUPAC Name | — |
| SMILES | CCCCC/C=C/C/C=C/CCCCCCCC(=O)OC[C@@H](O)COP(=O)(O)O.[Na] |
| InChI | InChI=1S/C21H39O7P.Na/c1-2-3-4-5-6-7-8-9-10-11-12-13-14-15-16-17-21(23)27-18-20(22)19-28-29(24,25)26;/h6-7,9-10,20,22H,2-5,8,11-19H2,1H3,(H2,24,25,26);/b7-6+,10-9+;/t20-;/m1./s1 |
| InChIKey | CLFDTXJHXXYCFR-HFWMBDOBSA-N |
| XLogP | 4.43 |
| TPSA | 113.29 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 19 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 457.50 |
| LogP ≤ 5 | 4.43 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|