C25H43O7P — CID 138191496
(2-hydroxy-3-phosphonooxypropyl) (10Z,13Z,16Z,19Z)-docosa-10,13,16,19-tetraenoate (PubChem CID 138191496) has the molecular formula C25H43O7P and a molecular weight of 486.59 g/mol. Its IUPAC name is (2-hydroxy-3-phosphonooxypropyl) (10Z,13Z,16Z,19Z)-docosa-10,13,16,19-tetraenoate.
| Compound Name | (2-hydroxy-3-phosphonooxypropyl) (10Z,13Z,16Z,19Z)-docosa-10,13,16,19-tetraenoate |
|---|---|
| PubChem CID | 138191496 |
| Molecular Formula | C25H43O7P |
| Molecular Weight | 486.59 g/mol |
| Exact Mass | 486.27 |
| IUPAC Name | (2-hydroxy-3-phosphonooxypropyl) (10Z,13Z,16Z,19Z)-docosa-10,13,16,19-tetraenoate |
| SMILES | CC/C=C\C/C=C\C/C=C\C/C=C\CCCCCCCCC(=O)OCC(O)COP(=O)(O)O |
| InChI | InChI=1S/C25H43O7P/c1-2-3-4-5-6-7-8-9-10-11-12-13-14-15-16-17-18-19-20-21-25(27)31-22-24(26)23-32-33(28,29)30/h3-4,6-7,9-10,12-13,24,26H,2,5,8,11,14-23H2,1H3,(H2,28,29,30)/b4-3-,7-6-,10-9-,13-12- |
| InChIKey | KARLIJKROVESIP-LTKCOYKYSA-N |
| XLogP | 5.93 |
| TPSA | 113.29 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 21 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 486.59 |
| LogP ≤ 5 | 5.93 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|