C20H39O7P — CID 3247018
[(2R)-2-hydroxy-3-phosphonooxypropyl] heptadec-9-enoate (PubChem CID 3247018) has the molecular formula C20H39O7P and a molecular weight of 422.50 g/mol. Its IUPAC name is [(2R)-2-hydroxy-3-phosphonooxypropyl] heptadec-9-enoate.
| Compound Name | [(2R)-2-hydroxy-3-phosphonooxypropyl] heptadec-9-enoate |
|---|---|
| PubChem CID | 3247018 |
| Molecular Formula | C20H39O7P |
| Molecular Weight | 422.50 g/mol |
| Exact Mass | 422.24 |
| IUPAC Name | [(2R)-2-hydroxy-3-phosphonooxypropyl] heptadec-9-enoate |
| SMILES | CCCCCCCC=CCCCCCCCC(=O)OC[C@@H](O)COP(=O)(O)O |
| InChI | InChI=1S/C20H39O7P/c1-2-3-4-5-6-7-8-9-10-11-12-13-14-15-16-20(22)26-17-19(21)18-27-28(23,24)25/h8-9,19,21H,2-7,10-18H2,1H3,(H2,23,24,25)/t19-/m1/s1 |
| InChIKey | PIVUMJCNAUHUPL-LJQANCHMSA-N |
| XLogP | 4.65 |
| TPSA | 113.29 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 19 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 422.50 |
| LogP ≤ 5 | 4.65 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|