C24H48O11P2 — CID 174207549
3-[hydroxy-(2-hydroxy-3-phosphonooxypropoxy)phosphoryl]oxypropyl (Z)-octadec-11-enoate (PubChem CID 174207549) has the molecular formula C24H48O11P2 and a molecular weight of 574.59 g/mol. Its IUPAC name is 3-[hydroxy-(2-hydroxy-3-phosphonooxypropoxy)phosphoryl]oxypropyl (Z)-octadec-11-enoate.
| Compound Name | 3-[hydroxy-(2-hydroxy-3-phosphonooxypropoxy)phosphoryl]oxypropyl (Z)-octadec-11-enoate |
|---|---|
| PubChem CID | 174207549 |
| Molecular Formula | C24H48O11P2 |
| Molecular Weight | 574.59 g/mol |
| Exact Mass | 574.27 |
| IUPAC Name | 3-[hydroxy-(2-hydroxy-3-phosphonooxypropoxy)phosphoryl]oxypropyl (Z)-octadec-11-enoate |
| SMILES | CCCCCC/C=C\CCCCCCCCCC(=O)OCCCOP(=O)(O)OCC(O)COP(=O)(O)O |
| InChI | InChI=1S/C24H48O11P2/c1-2-3-4-5-6-7-8-9-10-11-12-13-14-15-16-18-24(26)32-19-17-20-33-37(30,31)35-22-23(25)21-34-36(27,28)29/h7-8,23,25H,2-6,9-22H2,1H3,(H,30,31)(H2,27,28,29)/b8-7- |
| InChIKey | RXQGSQLSEKMIPR-FPLPWBNLSA-N |
| XLogP | 5.56 |
| TPSA | 169.05 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 26 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 574.59 |
| LogP ≤ 5 | 5.56 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|