C24H47O8P — CID 146426132
3-[2,3-dihydroxypropoxy(hydroxy)phosphoryl]oxypropyl (Z)-octadec-9-enoate (PubChem CID 146426132) has the molecular formula C24H47O8P and a molecular weight of 494.61 g/mol. Its IUPAC name is 3-[2,3-dihydroxypropoxy(hydroxy)phosphoryl]oxypropyl (Z)-octadec-9-enoate.
| Compound Name | 3-[2,3-dihydroxypropoxy(hydroxy)phosphoryl]oxypropyl (Z)-octadec-9-enoate |
|---|---|
| PubChem CID | 146426132 |
| Molecular Formula | C24H47O8P |
| Molecular Weight | 494.61 g/mol |
| Exact Mass | 494.30 |
| IUPAC Name | 3-[2,3-dihydroxypropoxy(hydroxy)phosphoryl]oxypropyl (Z)-octadec-9-enoate |
| SMILES | CCCCCCCC/C=C\CCCCCCCC(=O)OCCCOP(=O)(O)OCC(O)CO |
| InChI | InChI=1S/C24H47O8P/c1-2-3-4-5-6-7-8-9-10-11-12-13-14-15-16-18-24(27)30-19-17-20-31-33(28,29)32-22-23(26)21-25/h9-10,23,25-26H,2-8,11-22H2,1H3,(H,28,29)/b10-9- |
| InChIKey | FYJJBNJAXDPIOO-KTKRTIGZSA-N |
| XLogP | 5.44 |
| TPSA | 122.52 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 24 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 494.61 |
| LogP ≤ 5 | 5.44 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|