C38H71O10P — CID 138279189
[1-[2,3-dihydroxypropoxy(hydroxy)phosphoryl]oxy-3-[(Z)-pentadec-9-enoyl]oxypropan-2-yl] (Z)-heptadec-9-enoate (PubChem CID 138279189) has the molecular formula C38H71O10P and a molecular weight of 718.95 g/mol. Its IUPAC name is [1-[2,3-dihydroxypropoxy(hydroxy)phosphoryl]oxy-3-[(Z)-pentadec-9-enoyl]oxypropan-2-yl] (Z)-heptadec-9-enoate.
| Compound Name | [1-[2,3-dihydroxypropoxy(hydroxy)phosphoryl]oxy-3-[(Z)-pentadec-9-enoyl]oxypropan-2-yl] (Z)-heptadec-9-enoate |
|---|---|
| PubChem CID | 138279189 |
| Molecular Formula | C38H71O10P |
| Molecular Weight | 718.95 g/mol |
| Exact Mass | 718.48 |
| IUPAC Name | [1-[2,3-dihydroxypropoxy(hydroxy)phosphoryl]oxy-3-[(Z)-pentadec-9-enoyl]oxypropan-2-yl] (Z)-heptadec-9-enoate |
| SMILES | CCCCC/C=C\CCCCCCCC(=O)OCC(COP(=O)(O)OCC(O)CO)OC(=O)CCCCCCC/C=C\CCCCCCC |
| InChI | InChI=1S/C38H71O10P/c1-3-5-7-9-11-13-15-17-18-20-22-24-26-28-30-38(42)48-36(34-47-49(43,44)46-32-35(40)31-39)33-45-37(41)29-27-25-23-21-19-16-14-12-10-8-6-4-2/h12,14-15,17,35-36,39-40H,3-11,13,16,18-34H2,1-2H3,(H,43,44)/b14-12-,17-15- |
| InChIKey | VGIJNPMMIXDGAK-NERFDCTISA-N |
| XLogP | 9.44 |
| TPSA | 148.82 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 36 |
| Heavy Atoms | 49 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 718.95 |
| LogP ≤ 5 | 9.44 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|