C22H44NO7P — CID 134747276
[(2R)-3-[2-aminoethoxy(hydroxy)phosphoryl]oxy-2-hydroxypropyl] (E)-heptadec-9-enoate (PubChem CID 134747276) has the molecular formula C22H44NO7P and a molecular weight of 465.57 g/mol. Its IUPAC name is [(2R)-3-[2-aminoethoxy(hydroxy)phosphoryl]oxy-2-hydroxypropyl] (E)-heptadec-9-enoate.
| Compound Name | [(2R)-3-[2-aminoethoxy(hydroxy)phosphoryl]oxy-2-hydroxypropyl] (E)-heptadec-9-enoate |
|---|---|
| PubChem CID | 134747276 |
| Molecular Formula | C22H44NO7P |
| Molecular Weight | 465.57 g/mol |
| Exact Mass | 465.29 |
| IUPAC Name | [(2R)-3-[2-aminoethoxy(hydroxy)phosphoryl]oxy-2-hydroxypropyl] (E)-heptadec-9-enoate |
| SMILES | CCCCCCC/C=C/CCCCCCCC(=O)OC[C@@H](O)COP(=O)(O)OCCN |
| InChI | InChI=1S/C22H44NO7P/c1-2-3-4-5-6-7-8-9-10-11-12-13-14-15-16-22(25)28-19-21(24)20-30-31(26,27)29-18-17-23/h8-9,21,24H,2-7,10-20,23H2,1H3,(H,26,27)/b9-8+/t21-/m1/s1 |
| InChIKey | LNJNONCNASQZOB-MHNQQFQPSA-N |
| XLogP | 4.63 |
| TPSA | 128.31 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 22 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 465.57 |
| LogP ≤ 5 | 4.63 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|