C25H44NO7P — CID 58177716
[(2R)-3-[2-aminoethoxy(hydroxy)phosphoryl]oxy-2-hydroxypropyl] (6E,9E,12E,15E)-icosa-6,9,12,15-tetraenoate (PubChem CID 58177716) has the molecular formula C25H44NO7P and a molecular weight of 501.60 g/mol. Its IUPAC name is [(2R)-3-[2-aminoethoxy(hydroxy)phosphoryl]oxy-2-hydroxypropyl] (6E,9E,12E,15E)-icosa-6,9,12,15-tetraenoate.
| Compound Name | [(2R)-3-[2-aminoethoxy(hydroxy)phosphoryl]oxy-2-hydroxypropyl] (6E,9E,12E,15E)-icosa-6,9,12,15-tetraenoate |
|---|---|
| PubChem CID | 58177716 |
| Molecular Formula | C25H44NO7P |
| Molecular Weight | 501.60 g/mol |
| Exact Mass | 501.29 |
| IUPAC Name | [(2R)-3-[2-aminoethoxy(hydroxy)phosphoryl]oxy-2-hydroxypropyl] (6E,9E,12E,15E)-icosa-6,9,12,15-tetraenoate |
| SMILES | CCCC/C=C/C/C=C/C/C=C/C/C=C/CCCCC(=O)OC[C@@H](O)COP(=O)(O)OCCN |
| InChI | InChI=1S/C25H44NO7P/c1-2-3-4-5-6-7-8-9-10-11-12-13-14-15-16-17-18-19-25(28)31-22-24(27)23-33-34(29,30)32-21-20-26/h5-6,8-9,11-12,14-15,24,27H,2-4,7,10,13,16-23,26H2,1H3,(H,29,30)/b6-5+,9-8+,12-11+,15-14+/t24-/m1/s1 |
| InChIKey | XBRLSSCBTMGOSX-XMITUIDPSA-N |
| XLogP | 5.13 |
| TPSA | 128.31 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 22 |
| Heavy Atoms | 34 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 501.60 |
| LogP ≤ 5 | 5.13 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|