C19H38NO7P — CID 146037144
2-azaniumylethyl [(2R)-2-hydroxy-3-tetradec-7-enoyloxypropyl] phosphate (PubChem CID 146037144) has the molecular formula C19H38NO7P and a molecular weight of 423.49 g/mol. Its IUPAC name is 2-azaniumylethyl [(2R)-2-hydroxy-3-tetradec-7-enoyloxypropyl] phosphate.
| Compound Name | 2-azaniumylethyl [(2R)-2-hydroxy-3-tetradec-7-enoyloxypropyl] phosphate |
|---|---|
| PubChem CID | 146037144 |
| Molecular Formula | C19H38NO7P |
| Molecular Weight | 423.49 g/mol |
| Exact Mass | 423.24 |
| IUPAC Name | 2-azaniumylethyl [(2R)-2-hydroxy-3-tetradec-7-enoyloxypropyl] phosphate |
| SMILES | CCCCCCC=CCCCCCC(=O)OC[C@@H](O)COP(=O)([O-])OCC[NH3+] |
| InChI | InChI=1S/C19H38NO7P/c1-2-3-4-5-6-7-8-9-10-11-12-13-19(22)25-16-18(21)17-27-28(23,24)26-15-14-20/h7-8,18,21H,2-6,9-17,20H2,1H3,(H,23,24)/t18-/m1/s1 |
| InChIKey | RBKXDGUVZHKXHJ-GOSISDBHSA-N |
| XLogP | 2.11 |
| TPSA | 132.76 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 19 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 423.49 |
| LogP ≤ 5 | 2.11 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|