About dimethyl propyl phosphate;octadecanamide
dimethyl propyl phosphate;octadecanamide (PubChem CID 161011804) has the molecular formula C23H50NO5P
and a molecular weight of 451.63 g/mol. Its IUPAC name is dimethyl propyl phosphate;octadecanamide.
Molecular Properties
| Compound Name | dimethyl propyl phosphate;octadecanamide |
| PubChem CID | 161011804 |
| Molecular Formula | C23H50NO5P |
| Molecular Weight | 451.63 g/mol |
| Exact Mass | 451.34 |
| IUPAC Name | dimethyl propyl phosphate;octadecanamide |
| SMILES | CCCCCCCCCCCCCCCCCC(N)=O.CCCOP(=O)(OC)OC |
| InChI | InChI=1S/C18H37NO.C5H13O4P/c1-2-3-4-5-6-7-8-9-10-11-12-13-14-15-16-17-18(19)20;1-4-5-9-10(6,7-2)8-3/h2-17H2,1H3,(H2,19,20);4-5H2,1-3H3 |
| InChIKey | TXFHLHXXVZGSIY-UHFFFAOYSA-N |
| XLogP | 7.55 |
| TPSA | 87.85 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 21 |
| Heavy Atoms | 30 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 451.63 |
| LogP ≤ 5 | 7.55 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|
Analyze dimethyl propyl phosphate;octadecanamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of dimethyl propyl phosphate;octadecanamide?
The IUPAC name of dimethyl propyl phosphate;octadecanamide (CID 161011804) is dimethyl propyl phosphate;octadecanamide.
What is the SMILES notation for dimethyl propyl phosphate;octadecanamide?
The canonical SMILES for dimethyl propyl phosphate;octadecanamide is CCCCCCCCCCCCCCCCCC(N)=O.CCCOP(=O)(OC)OC.
What is the InChIKey of dimethyl propyl phosphate;octadecanamide?
The InChIKey is TXFHLHXXVZGSIY-UHFFFAOYSA-N. The full InChI is InChI=1S/C18H37NO.C5H13O4P/c1-2-3-4-5-6-7-8-9-10-11-12-13-14-15-16-17-18(19)20;1-4-5-9-10(6,7-2)8-3/h2-17H2,1H3,(H2,19,20);4-5H2,1-3H3.
What are the key properties of dimethyl propyl phosphate;octadecanamide?
dimethyl propyl phosphate;octadecanamide has a molecular weight of 451.63 g/mol, XLogP of 7.55, 21 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for dimethyl propyl phosphate;octadecanamide is sourced from PubChem (CID 161011804), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).