About octadecanamide;hydrochloride
octadecanamide;hydrochloride (PubChem CID 87891779) has the molecular formula C18H38ClNO
and a molecular weight of 319.96 g/mol. Its IUPAC name is octadecanamide;hydrochloride.
Molecular Properties
| Compound Name | octadecanamide;hydrochloride |
| PubChem CID | 87891779 |
| Molecular Formula | C18H38ClNO |
| Molecular Weight | 319.96 g/mol |
| Exact Mass | 319.26 |
| IUPAC Name | octadecanamide;hydrochloride |
| SMILES | CCCCCCCCCCCCCCCCCC(N)=O.Cl |
| InChI | InChI=1S/C18H37NO.ClH/c1-2-3-4-5-6-7-8-9-10-11-12-13-14-15-16-17-18(19)20;/h2-17H2,1H3,(H2,19,20);1H |
| InChIKey | DXDHTWPMNOEUAK-UHFFFAOYSA-N |
| XLogP | 6.16 |
| TPSA | 43.09 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 319.96 |
| LogP ≤ 5 | 6.16 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze octadecanamide;hydrochloride with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of octadecanamide;hydrochloride?
The IUPAC name of octadecanamide;hydrochloride (CID 87891779) is octadecanamide;hydrochloride.
What is the SMILES notation for octadecanamide;hydrochloride?
The canonical SMILES for octadecanamide;hydrochloride is CCCCCCCCCCCCCCCCCC(N)=O.Cl.
What is the InChIKey of octadecanamide;hydrochloride?
The InChIKey is DXDHTWPMNOEUAK-UHFFFAOYSA-N. The full InChI is InChI=1S/C18H37NO.ClH/c1-2-3-4-5-6-7-8-9-10-11-12-13-14-15-16-17-18(19)20;/h2-17H2,1H3,(H2,19,20);1H.
What are the key properties of octadecanamide;hydrochloride?
octadecanamide;hydrochloride has a molecular weight of 319.96 g/mol, XLogP of 6.16, 16 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for octadecanamide;hydrochloride is sourced from PubChem (CID 87891779), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).