About butane;octanamide
butane;octanamide (PubChem CID 87511414) has the molecular formula C12H27NO
and a molecular weight of 201.35 g/mol. Its IUPAC name is butane;octanamide.
Molecular Properties
| Compound Name | butane;octanamide |
| PubChem CID | 87511414 |
| Molecular Formula | C12H27NO |
| Molecular Weight | 201.35 g/mol |
| Exact Mass | 201.21 |
| IUPAC Name | butane;octanamide |
| SMILES | CCCC.CCCCCCCC(N)=O |
| InChI | InChI=1S/C8H17NO.C4H10/c1-2-3-4-5-6-7-8(9)10;1-3-4-2/h2-7H2,1H3,(H2,9,10);3-4H2,1-2H3 |
| InChIKey | FCBBEMCCYWVQIE-UHFFFAOYSA-N |
| XLogP | 3.64 |
| TPSA | 43.09 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 201.35 |
| LogP ≤ 5 | 3.64 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze butane;octanamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of butane;octanamide?
The IUPAC name of butane;octanamide (CID 87511414) is butane;octanamide.
What is the SMILES notation for butane;octanamide?
The canonical SMILES for butane;octanamide is CCCC.CCCCCCCC(N)=O.
What is the InChIKey of butane;octanamide?
The InChIKey is FCBBEMCCYWVQIE-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H17NO.C4H10/c1-2-3-4-5-6-7-8(9)10;1-3-4-2/h2-7H2,1H3,(H2,9,10);3-4H2,1-2H3.
What are the key properties of butane;octanamide?
butane;octanamide has a molecular weight of 201.35 g/mol, XLogP of 3.64, 7 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for butane;octanamide is sourced from PubChem (CID 87511414), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).