About acetamide;decanamide;dihydrochloride
acetamide;decanamide;dihydrochloride (PubChem CID 141131942) has the molecular formula C12H28Cl2N2O2
and a molecular weight of 303.27 g/mol. Its IUPAC name is acetamide;decanamide;dihydrochloride.
Molecular Properties
| Compound Name | acetamide;decanamide;dihydrochloride |
| PubChem CID | 141131942 |
| Molecular Formula | C12H28Cl2N2O2 |
| Molecular Weight | 303.27 g/mol |
| Exact Mass | 302.15 |
| IUPAC Name | acetamide;decanamide;dihydrochloride |
| SMILES | CC(N)=O.CCCCCCCCCC(N)=O.Cl.Cl |
| InChI | InChI=1S/C10H21NO.C2H5NO.2ClH/c1-2-3-4-5-6-7-8-9-10(11)12;1-2(3)4;;/h2-9H2,1H3,(H2,11,12);1H3,(H2,3,4);2*1H |
| InChIKey | GDIFCRZIFIZKQV-UHFFFAOYSA-N |
| XLogP | 2.95 |
| TPSA | 86.18 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 303.27 |
| LogP ≤ 5 | 2.95 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze acetamide;decanamide;dihydrochloride with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of acetamide;decanamide;dihydrochloride?
The IUPAC name of acetamide;decanamide;dihydrochloride (CID 141131942) is acetamide;decanamide;dihydrochloride.
What is the SMILES notation for acetamide;decanamide;dihydrochloride?
The canonical SMILES for acetamide;decanamide;dihydrochloride is CC(N)=O.CCCCCCCCCC(N)=O.Cl.Cl.
What is the InChIKey of acetamide;decanamide;dihydrochloride?
The InChIKey is GDIFCRZIFIZKQV-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H21NO.C2H5NO.2ClH/c1-2-3-4-5-6-7-8-9-10(11)12;1-2(3)4;;/h2-9H2,1H3,(H2,11,12);1H3,(H2,3,4);2*1H.
What are the key properties of acetamide;decanamide;dihydrochloride?
acetamide;decanamide;dihydrochloride has a molecular weight of 303.27 g/mol, XLogP of 2.95, 8 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for acetamide;decanamide;dihydrochloride is sourced from PubChem (CID 141131942), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).