About acetamide;pentanamide;dihydrochloride
acetamide;pentanamide;dihydrochloride (PubChem CID 141201232) has the molecular formula C7H18Cl2N2O2
and a molecular weight of 233.14 g/mol. Its IUPAC name is acetamide;pentanamide;dihydrochloride.
Molecular Properties
| Compound Name | acetamide;pentanamide;dihydrochloride |
| PubChem CID | 141201232 |
| Molecular Formula | C7H18Cl2N2O2 |
| Molecular Weight | 233.14 g/mol |
| Exact Mass | 232.07 |
| IUPAC Name | acetamide;pentanamide;dihydrochloride |
| SMILES | CC(N)=O.CCCCC(N)=O.Cl.Cl |
| InChI | InChI=1S/C5H11NO.C2H5NO.2ClH/c1-2-3-4-5(6)7;1-2(3)4;;/h2-4H2,1H3,(H2,6,7);1H3,(H2,3,4);2*1H |
| InChIKey | CQNKGFFHFHNGLE-UHFFFAOYSA-N |
| XLogP | 1.00 |
| TPSA | 86.18 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 233.14 |
| LogP ≤ 5 | 1.00 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze acetamide;pentanamide;dihydrochloride with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of acetamide;pentanamide;dihydrochloride?
The IUPAC name of acetamide;pentanamide;dihydrochloride (CID 141201232) is acetamide;pentanamide;dihydrochloride.
What is the SMILES notation for acetamide;pentanamide;dihydrochloride?
The canonical SMILES for acetamide;pentanamide;dihydrochloride is CC(N)=O.CCCCC(N)=O.Cl.Cl.
What is the InChIKey of acetamide;pentanamide;dihydrochloride?
The InChIKey is CQNKGFFHFHNGLE-UHFFFAOYSA-N. The full InChI is InChI=1S/C5H11NO.C2H5NO.2ClH/c1-2-3-4-5(6)7;1-2(3)4;;/h2-4H2,1H3,(H2,6,7);1H3,(H2,3,4);2*1H.
What are the key properties of acetamide;pentanamide;dihydrochloride?
acetamide;pentanamide;dihydrochloride has a molecular weight of 233.14 g/mol, XLogP of 1.00, 3 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for acetamide;pentanamide;dihydrochloride is sourced from PubChem (CID 141201232), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).