About butanamide;hexan-2-one;propane
butanamide;hexan-2-one;propane (PubChem CID 145305673) has the molecular formula C13H29NO2
and a molecular weight of 231.38 g/mol. Its IUPAC name is butanamide;hexan-2-one;propane.
Molecular Properties
| Compound Name | butanamide;hexan-2-one;propane |
| PubChem CID | 145305673 |
| Molecular Formula | C13H29NO2 |
| Molecular Weight | 231.38 g/mol |
| Exact Mass | 231.22 |
| IUPAC Name | butanamide;hexan-2-one;propane |
| SMILES | CCC.CCCC(N)=O.CCCCC(C)=O |
| InChI | InChI=1S/C6H12O.C4H9NO.C3H8/c1-3-4-5-6(2)7;1-2-3-4(5)6;1-3-2/h3-5H2,1-2H3;2-3H2,1H3,(H2,5,6);3H2,1-2H3 |
| InChIKey | TUPXHCVBMBWVMI-UHFFFAOYSA-N |
| XLogP | 3.45 |
| TPSA | 60.16 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 231.38 |
| LogP ≤ 5 | 3.45 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze butanamide;hexan-2-one;propane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of butanamide;hexan-2-one;propane?
The IUPAC name of butanamide;hexan-2-one;propane (CID 145305673) is butanamide;hexan-2-one;propane.
What is the SMILES notation for butanamide;hexan-2-one;propane?
The canonical SMILES for butanamide;hexan-2-one;propane is CCC.CCCC(N)=O.CCCCC(C)=O.
What is the InChIKey of butanamide;hexan-2-one;propane?
The InChIKey is TUPXHCVBMBWVMI-UHFFFAOYSA-N. The full InChI is InChI=1S/C6H12O.C4H9NO.C3H8/c1-3-4-5-6(2)7;1-2-3-4(5)6;1-3-2/h3-5H2,1-2H3;2-3H2,1H3,(H2,5,6);3H2,1-2H3.
What are the key properties of butanamide;hexan-2-one;propane?
butanamide;hexan-2-one;propane has a molecular weight of 231.38 g/mol, XLogP of 3.45, 5 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for butanamide;hexan-2-one;propane is sourced from PubChem (CID 145305673), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).