About ethene;hexan-2-one
ethene;hexan-2-one (PubChem CID 88765599) has the molecular formula C8H16O
and a molecular weight of 128.21 g/mol. Its IUPAC name is ethene;hexan-2-one.
Molecular Properties
| Compound Name | ethene;hexan-2-one |
| PubChem CID | 88765599 |
| Molecular Formula | C8H16O |
| Molecular Weight | 128.21 g/mol |
| Exact Mass | 128.12 |
| IUPAC Name | ethene;hexan-2-one |
| SMILES | C=C.CCCCC(C)=O |
| InChI | InChI=1S/C6H12O.C2H4/c1-3-4-5-6(2)7;1-2/h3-5H2,1-2H3;1-2H2 |
| InChIKey | PZOFCYFGXONRHC-UHFFFAOYSA-N |
| XLogP | 2.57 |
| TPSA | 17.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 9 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 128.21 |
| LogP ≤ 5 | 2.57 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze ethene;hexan-2-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of ethene;hexan-2-one?
The IUPAC name of ethene;hexan-2-one (CID 88765599) is ethene;hexan-2-one.
What is the SMILES notation for ethene;hexan-2-one?
The canonical SMILES for ethene;hexan-2-one is C=C.CCCCC(C)=O.
What is the InChIKey of ethene;hexan-2-one?
The InChIKey is PZOFCYFGXONRHC-UHFFFAOYSA-N. The full InChI is InChI=1S/C6H12O.C2H4/c1-3-4-5-6(2)7;1-2/h3-5H2,1-2H3;1-2H2.
What are the key properties of ethene;hexan-2-one?
ethene;hexan-2-one has a molecular weight of 128.21 g/mol, XLogP of 2.57, 3 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for ethene;hexan-2-one is sourced from PubChem (CID 88765599), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).