About methanol;octan-2-one
methanol;octan-2-one (PubChem CID 158579665) has the molecular formula C9H20O2
and a molecular weight of 160.26 g/mol. Its IUPAC name is methanol;octan-2-one.
Molecular Properties
| Compound Name | methanol;octan-2-one |
| PubChem CID | 158579665 |
| Molecular Formula | C9H20O2 |
| Molecular Weight | 160.26 g/mol |
| Exact Mass | 160.15 |
| IUPAC Name | methanol;octan-2-one |
| SMILES | CCCCCCC(C)=O.CO |
| InChI | InChI=1S/C8H16O.CH4O/c1-3-4-5-6-7-8(2)9;1-2/h3-7H2,1-2H3;2H,1H3 |
| InChIKey | HTCCITYMZRRBAT-UHFFFAOYSA-N |
| XLogP | 2.15 |
| TPSA | 37.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 160.26 |
| LogP ≤ 5 | 2.15 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze methanol;octan-2-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of methanol;octan-2-one?
The IUPAC name of methanol;octan-2-one (CID 158579665) is methanol;octan-2-one.
What is the SMILES notation for methanol;octan-2-one?
The canonical SMILES for methanol;octan-2-one is CCCCCCC(C)=O.CO.
What is the InChIKey of methanol;octan-2-one?
The InChIKey is HTCCITYMZRRBAT-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H16O.CH4O/c1-3-4-5-6-7-8(2)9;1-2/h3-7H2,1-2H3;2H,1H3.
What are the key properties of methanol;octan-2-one?
methanol;octan-2-one has a molecular weight of 160.26 g/mol, XLogP of 2.15, 5 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for methanol;octan-2-one is sourced from PubChem (CID 158579665), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).