About molybdenum;octan-2-one;hydrate
molybdenum;octan-2-one;hydrate (PubChem CID 174900945) has the molecular formula C8H18MoO2
and a molecular weight of 242.17 g/mol. Its IUPAC name is molybdenum;octan-2-one;hydrate.
Molecular Properties
| Compound Name | molybdenum;octan-2-one;hydrate |
| PubChem CID | 174900945 |
| Molecular Formula | C8H18MoO2 |
| Molecular Weight | 242.17 g/mol |
| Exact Mass | 244.04 |
| IUPAC Name | molybdenum;octan-2-one;hydrate |
| SMILES | CCCCCCC(C)=O.O.[Mo] |
| InChI | InChI=1S/C8H16O.Mo.H2O/c1-3-4-5-6-7-8(2)9;;/h3-7H2,1-2H3;;1H2 |
| InChIKey | FCEODDPRMQUNSB-UHFFFAOYSA-N |
| XLogP | 1.72 |
| TPSA | 48.57 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 242.17 |
| LogP ≤ 5 | 1.72 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze molybdenum;octan-2-one;hydrate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of molybdenum;octan-2-one;hydrate?
The IUPAC name of molybdenum;octan-2-one;hydrate (CID 174900945) is molybdenum;octan-2-one;hydrate.
What is the SMILES notation for molybdenum;octan-2-one;hydrate?
The canonical SMILES for molybdenum;octan-2-one;hydrate is CCCCCCC(C)=O.O.[Mo].
What is the InChIKey of molybdenum;octan-2-one;hydrate?
The InChIKey is FCEODDPRMQUNSB-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H16O.Mo.H2O/c1-3-4-5-6-7-8(2)9;;/h3-7H2,1-2H3;;1H2.
What are the key properties of molybdenum;octan-2-one;hydrate?
molybdenum;octan-2-one;hydrate has a molecular weight of 242.17 g/mol, XLogP of 1.72, 5 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for molybdenum;octan-2-one;hydrate is sourced from PubChem (CID 174900945), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).