About methane;octan-2-one
methane;octan-2-one (PubChem CID 159061487) has the molecular formula C9H20O
and a molecular weight of 144.26 g/mol. Its IUPAC name is methane;octan-2-one.
Molecular Properties
| Compound Name | methane;octan-2-one |
| PubChem CID | 159061487 |
| Molecular Formula | C9H20O |
| Molecular Weight | 144.26 g/mol |
| Exact Mass | 144.15 |
| IUPAC Name | methane;octan-2-one |
| SMILES | C.CCCCCCC(C)=O |
| InChI | InChI=1S/C8H16O.CH4/c1-3-4-5-6-7-8(2)9;/h3-7H2,1-2H3;1H4 |
| InChIKey | LMUUTLWUULPNCR-UHFFFAOYSA-N |
| XLogP | 3.18 |
| TPSA | 17.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 10 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 144.26 |
| LogP ≤ 5 | 3.18 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze methane;octan-2-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of methane;octan-2-one?
The IUPAC name of methane;octan-2-one (CID 159061487) is methane;octan-2-one.
What is the SMILES notation for methane;octan-2-one?
The canonical SMILES for methane;octan-2-one is C.CCCCCCC(C)=O.
What is the InChIKey of methane;octan-2-one?
The InChIKey is LMUUTLWUULPNCR-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H16O.CH4/c1-3-4-5-6-7-8(2)9;/h3-7H2,1-2H3;1H4.
What are the key properties of methane;octan-2-one?
methane;octan-2-one has a molecular weight of 144.26 g/mol, XLogP of 3.18, 5 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for methane;octan-2-one is sourced from PubChem (CID 159061487), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).