About docosan-2-one
docosan-2-one (PubChem CID 522660) has the molecular formula C22H44O
and a molecular weight of 324.59 g/mol. Its IUPAC name is docosan-2-one.
Molecular Properties
| Compound Name | docosan-2-one |
| PubChem CID | 522660 |
| Molecular Formula | C22H44O |
| Molecular Weight | 324.59 g/mol |
| Exact Mass | 324.34 |
| IUPAC Name | docosan-2-one |
| SMILES | CCCCCCCCCCCCCCCCCCCCC(C)=O |
| InChI | InChI=1S/C22H44O/c1-3-4-5-6-7-8-9-10-11-12-13-14-15-16-17-18-19-20-21-22(2)23/h3-21H2,1-2H3 |
| InChIKey | TWBHLKOHVHGYGC-UHFFFAOYSA-N |
| XLogP | 8.01 |
| TPSA | 17.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 19 |
| Heavy Atoms | 23 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 324.59 |
| LogP ≤ 5 | 8.01 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze docosan-2-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of docosan-2-one?
The IUPAC name of docosan-2-one (CID 522660) is docosan-2-one.
What is the SMILES notation for docosan-2-one?
The canonical SMILES for docosan-2-one is CCCCCCCCCCCCCCCCCCCCC(C)=O.
What is the InChIKey of docosan-2-one?
The InChIKey is TWBHLKOHVHGYGC-UHFFFAOYSA-N. The full InChI is InChI=1S/C22H44O/c1-3-4-5-6-7-8-9-10-11-12-13-14-15-16-17-18-19-20-21-22(2)23/h3-21H2,1-2H3.
What are the key properties of docosan-2-one?
docosan-2-one has a molecular weight of 324.59 g/mol, XLogP of 8.01, 19 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for docosan-2-one is sourced from PubChem (CID 522660), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).