About sodium;ethane;heptadecan-2-one
sodium;ethane;heptadecan-2-one (PubChem CID 167668217) has the molecular formula C19H40NaO+
and a molecular weight of 307.52 g/mol. Its IUPAC name is sodium;ethane;heptadecan-2-one.
Molecular Properties
| Compound Name | sodium;ethane;heptadecan-2-one |
| PubChem CID | 167668217 |
| Molecular Formula | C19H40NaO+ |
| Molecular Weight | 307.52 g/mol |
| Exact Mass | 307.30 |
| IUPAC Name | sodium;ethane;heptadecan-2-one |
| SMILES | CC.CCCCCCCCCCCCCCCC(C)=O.[Na+] |
| InChI | InChI=1S/C17H34O.C2H6.Na/c1-3-4-5-6-7-8-9-10-11-12-13-14-15-16-17(2)18;1-2;/h3-16H2,1-2H3;1-2H3;/q;;+1 |
| InChIKey | CFYISUNWLQYDTP-UHFFFAOYSA-N |
| XLogP | 4.09 |
| TPSA | 17.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 307.52 |
| LogP ≤ 5 | 4.09 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze sodium;ethane;heptadecan-2-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of sodium;ethane;heptadecan-2-one?
The IUPAC name of sodium;ethane;heptadecan-2-one (CID 167668217) is sodium;ethane;heptadecan-2-one.
What is the SMILES notation for sodium;ethane;heptadecan-2-one?
The canonical SMILES for sodium;ethane;heptadecan-2-one is CC.CCCCCCCCCCCCCCCC(C)=O.[Na+].
What is the InChIKey of sodium;ethane;heptadecan-2-one?
The InChIKey is CFYISUNWLQYDTP-UHFFFAOYSA-N. The full InChI is InChI=1S/C17H34O.C2H6.Na/c1-3-4-5-6-7-8-9-10-11-12-13-14-15-16-17(2)18;1-2;/h3-16H2,1-2H3;1-2H3;/q;;+1.
What are the key properties of sodium;ethane;heptadecan-2-one?
sodium;ethane;heptadecan-2-one has a molecular weight of 307.52 g/mol, XLogP of 4.09, 14 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for sodium;ethane;heptadecan-2-one is sourced from PubChem (CID 167668217), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).