About tricosan-2-one
tricosan-2-one (PubChem CID 529806) has the molecular formula C23H46O
and a molecular weight of 338.62 g/mol. Its IUPAC name is tricosan-2-one.
Molecular Properties
| Compound Name | tricosan-2-one |
| PubChem CID | 529806 |
| Molecular Formula | C23H46O |
| Molecular Weight | 338.62 g/mol |
| Exact Mass | 338.35 |
| IUPAC Name | tricosan-2-one |
| SMILES | CCCCCCCCCCCCCCCCCCCCCC(C)=O |
| InChI | InChI=1S/C23H46O/c1-3-4-5-6-7-8-9-10-11-12-13-14-15-16-17-18-19-20-21-22-23(2)24/h3-22H2,1-2H3 |
| InChIKey | HMGAHRPPRPQDAS-UHFFFAOYSA-N |
| XLogP | 8.40 |
| TPSA | 17.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 20 |
| Heavy Atoms | 24 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 338.62 |
| LogP ≤ 5 | 8.40 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze tricosan-2-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of tricosan-2-one?
The IUPAC name of tricosan-2-one (CID 529806) is tricosan-2-one.
What is the SMILES notation for tricosan-2-one?
The canonical SMILES for tricosan-2-one is CCCCCCCCCCCCCCCCCCCCCC(C)=O.
What is the InChIKey of tricosan-2-one?
The InChIKey is HMGAHRPPRPQDAS-UHFFFAOYSA-N. The full InChI is InChI=1S/C23H46O/c1-3-4-5-6-7-8-9-10-11-12-13-14-15-16-17-18-19-20-21-22-23(2)24/h3-22H2,1-2H3.
What are the key properties of tricosan-2-one?
tricosan-2-one has a molecular weight of 338.62 g/mol, XLogP of 8.40, 20 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for tricosan-2-one is sourced from PubChem (CID 529806), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).