About octadecakis(hexane);nonan-2-one
octadecakis(hexane);nonan-2-one (PubChem CID 173226284) has the molecular formula C117H270O
and a molecular weight of 1693.45 g/mol. Its IUPAC name is octadecakis(hexane);nonan-2-one.
Molecular Properties
| Compound Name | octadecakis(hexane);nonan-2-one |
| PubChem CID | 173226284 |
| Molecular Formula | C117H270O |
| Molecular Weight | 1693.45 g/mol |
| Exact Mass | 1692.11 |
| IUPAC Name | octadecakis(hexane);nonan-2-one |
| SMILES | CCCCCC.CCCCCC.CCCCCC.CCCCCC.CCCCCC.CCCCCC.CCCCCC.CCCCCC.CCCCCC.CCCCCC.CCCCCC.CCCCCC.CCCCCC.CCCCCC.CCCCCC.CCCCCC.CCCCCC.CCCCCC.CCCCCCCC(C)=O |
| InChI | InChI=1S/C9H18O.18C6H14/c1-3-4-5-6-7-8-9(2)10;18*1-3-5-6-4-2/h3-8H2,1-2H3;18*3-6H2,1-2H3 |
| InChIKey | BOWSTZCGALXTAK-UHFFFAOYSA-N |
| XLogP | 49.49 |
| TPSA | 17.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 60 |
| Heavy Atoms | 118 |
| Complexity | — |
Lipinski Rule of Five
2 violations
| Rule | Value |
| MW ≤ 500 | 1693.45 |
| LogP ≤ 5 | 49.49 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze octadecakis(hexane);nonan-2-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of octadecakis(hexane);nonan-2-one?
The IUPAC name of octadecakis(hexane);nonan-2-one (CID 173226284) is octadecakis(hexane);nonan-2-one.
What is the SMILES notation for octadecakis(hexane);nonan-2-one?
The canonical SMILES for octadecakis(hexane);nonan-2-one is CCCCCC.CCCCCC.CCCCCC.CCCCCC.CCCCCC.CCCCCC.CCCCCC.CCCCCC.CCCCCC.CCCCCC.CCCCCC.CCCCCC.CCCCCC.CCCCCC.CCCCCC.CCCCCC.CCCCCC.CCCCCC.CCCCCCCC(C)=O.
What is the InChIKey of octadecakis(hexane);nonan-2-one?
The InChIKey is BOWSTZCGALXTAK-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H18O.18C6H14/c1-3-4-5-6-7-8-9(2)10;18*1-3-5-6-4-2/h3-8H2,1-2H3;18*3-6H2,1-2H3.
What are the key properties of octadecakis(hexane);nonan-2-one?
octadecakis(hexane);nonan-2-one has a molecular weight of 1693.45 g/mol, XLogP of 49.49, 60 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for octadecakis(hexane);nonan-2-one is sourced from PubChem (CID 173226284), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).