About nonan-2-one
nonan-2-one (PubChem CID 13187) has the molecular formula C9H18O
and a molecular weight of 142.24 g/mol. Its IUPAC name is nonan-2-one.
Molecular Properties
| Compound Name | nonan-2-one |
| PubChem CID | 13187 |
| Molecular Formula | C9H18O |
| Molecular Weight | 142.24 g/mol |
| Exact Mass | 142.14 |
| IUPAC Name | nonan-2-one |
| SMILES | CCCCCCCC(C)=O |
| InChI | InChI=1S/C9H18O/c1-3-4-5-6-7-8-9(2)10/h3-8H2,1-2H3 |
| InChIKey | VKCYHJWLYTUGCC-UHFFFAOYSA-N |
| XLogP | 2.94 |
| TPSA | 17.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 10 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 142.24 |
| LogP ≤ 5 | 2.94 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze nonan-2-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of nonan-2-one?
The IUPAC name of nonan-2-one (CID 13187) is nonan-2-one.
What is the SMILES notation for nonan-2-one?
The canonical SMILES for nonan-2-one is CCCCCCCC(C)=O.
What is the InChIKey of nonan-2-one?
The InChIKey is VKCYHJWLYTUGCC-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H18O/c1-3-4-5-6-7-8-9(2)10/h3-8H2,1-2H3.
What are the key properties of nonan-2-one?
nonan-2-one has a molecular weight of 142.24 g/mol, XLogP of 2.94, 6 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for nonan-2-one is sourced from PubChem (CID 13187), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).