About hexan-2-one;molecular nitrogen
hexan-2-one;molecular nitrogen (PubChem CID 174442577) has the molecular formula C6H12N2O
and a molecular weight of 128.17 g/mol. Its IUPAC name is hexan-2-one;molecular nitrogen.
Molecular Properties
| Compound Name | hexan-2-one;molecular nitrogen |
| PubChem CID | 174442577 |
| Molecular Formula | C6H12N2O |
| Molecular Weight | 128.17 g/mol |
| Exact Mass | 128.09 |
| IUPAC Name | hexan-2-one;molecular nitrogen |
| SMILES | CCCCC(C)=O.N#N |
| InChI | InChI=1S/C6H12O.N2/c1-3-4-5-6(2)7;1-2/h3-5H2,1-2H3; |
| InChIKey | JWMUKWQIQJHXPR-UHFFFAOYSA-N |
| XLogP | 1.80 |
| TPSA | 64.65 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 9 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 128.17 |
| LogP ≤ 5 | 1.80 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Azo_group', 'substructure': 'N/A'} |
|---|
Analyze hexan-2-one;molecular nitrogen with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of hexan-2-one;molecular nitrogen?
The IUPAC name of hexan-2-one;molecular nitrogen (CID 174442577) is hexan-2-one;molecular nitrogen.
What is the SMILES notation for hexan-2-one;molecular nitrogen?
The canonical SMILES for hexan-2-one;molecular nitrogen is CCCCC(C)=O.N#N.
What is the InChIKey of hexan-2-one;molecular nitrogen?
The InChIKey is JWMUKWQIQJHXPR-UHFFFAOYSA-N. The full InChI is InChI=1S/C6H12O.N2/c1-3-4-5-6(2)7;1-2/h3-5H2,1-2H3;.
What are the key properties of hexan-2-one;molecular nitrogen?
hexan-2-one;molecular nitrogen has a molecular weight of 128.17 g/mol, XLogP of 1.80, 3 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for hexan-2-one;molecular nitrogen is sourced from PubChem (CID 174442577), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).