About potassium;butanamide;hydride
potassium;butanamide;hydride (PubChem CID 174374590) has the molecular formula C4H10KNO
and a molecular weight of 127.23 g/mol. Its IUPAC name is potassium;butanamide;hydride.
Molecular Properties
| Compound Name | potassium;butanamide;hydride |
| PubChem CID | 174374590 |
| Molecular Formula | C4H10KNO |
| Molecular Weight | 127.23 g/mol |
| Exact Mass | 127.04 |
| IUPAC Name | potassium;butanamide;hydride |
| SMILES | CCCC(N)=O.[H-].[K+] |
| InChI | InChI=1S/C4H9NO.K.H/c1-2-3-4(5)6;;/h2-3H2,1H3,(H2,5,6);;/q;+1;-1 |
| InChIKey | DCZZPWKWJPSSOU-UHFFFAOYSA-N |
| XLogP | -2.61 |
| TPSA | 43.09 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 7 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 127.23 |
| LogP ≤ 5 | -2.61 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze potassium;butanamide;hydride with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of potassium;butanamide;hydride?
The IUPAC name of potassium;butanamide;hydride (CID 174374590) is potassium;butanamide;hydride.
What is the SMILES notation for potassium;butanamide;hydride?
The canonical SMILES for potassium;butanamide;hydride is CCCC(N)=O.[H-].[K+].
What is the InChIKey of potassium;butanamide;hydride?
The InChIKey is DCZZPWKWJPSSOU-UHFFFAOYSA-N. The full InChI is InChI=1S/C4H9NO.K.H/c1-2-3-4(5)6;;/h2-3H2,1H3,(H2,5,6);;/q;+1;-1.
What are the key properties of potassium;butanamide;hydride?
potassium;butanamide;hydride has a molecular weight of 127.23 g/mol, XLogP of -2.61, 2 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for potassium;butanamide;hydride is sourced from PubChem (CID 174374590), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).