About amino-oxido-oxophosphanium;butanamide
amino-oxido-oxophosphanium;butanamide (PubChem CID 174709936) has the molecular formula C4H11N2O3P
and a molecular weight of 166.12 g/mol. Its IUPAC name is amino-oxido-oxophosphanium;butanamide.
Molecular Properties
| Compound Name | amino-oxido-oxophosphanium;butanamide |
| PubChem CID | 174709936 |
| Molecular Formula | C4H11N2O3P |
| Molecular Weight | 166.12 g/mol |
| Exact Mass | 166.05 |
| IUPAC Name | amino-oxido-oxophosphanium;butanamide |
| SMILES | CCCC(N)=O.N[P+](=O)[O-] |
| InChI | InChI=1S/C4H9NO.H2NO2P/c1-2-3-4(5)6;1-4(2)3/h2-3H2,1H3,(H2,5,6);(H2,1,2,3) |
| InChIKey | SCDZIZHDKVNBPC-UHFFFAOYSA-N |
| XLogP | -0.77 |
| TPSA | 109.24 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 10 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 166.12 |
| LogP ≤ 5 | -0.77 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|
Analyze amino-oxido-oxophosphanium;butanamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of amino-oxido-oxophosphanium;butanamide?
The IUPAC name of amino-oxido-oxophosphanium;butanamide (CID 174709936) is amino-oxido-oxophosphanium;butanamide.
What is the SMILES notation for amino-oxido-oxophosphanium;butanamide?
The canonical SMILES for amino-oxido-oxophosphanium;butanamide is CCCC(N)=O.N[P+](=O)[O-].
What is the InChIKey of amino-oxido-oxophosphanium;butanamide?
The InChIKey is SCDZIZHDKVNBPC-UHFFFAOYSA-N. The full InChI is InChI=1S/C4H9NO.H2NO2P/c1-2-3-4(5)6;1-4(2)3/h2-3H2,1H3,(H2,5,6);(H2,1,2,3).
What are the key properties of amino-oxido-oxophosphanium;butanamide?
amino-oxido-oxophosphanium;butanamide has a molecular weight of 166.12 g/mol, XLogP of -0.77, 2 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for amino-oxido-oxophosphanium;butanamide is sourced from PubChem (CID 174709936), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).