About butanamide;dihydrobromide
butanamide;dihydrobromide (PubChem CID 140988378) has the molecular formula C4H11Br2NO
and a molecular weight of 248.95 g/mol. Its IUPAC name is butanamide;dihydrobromide.
Molecular Properties
| Compound Name | butanamide;dihydrobromide |
| PubChem CID | 140988378 |
| Molecular Formula | C4H11Br2NO |
| Molecular Weight | 248.95 g/mol |
| Exact Mass | 246.92 |
| IUPAC Name | butanamide;dihydrobromide |
| SMILES | Br.Br.CCCC(N)=O |
| InChI | InChI=1S/C4H9NO.2BrH/c1-2-3-4(5)6;;/h2-3H2,1H3,(H2,5,6);2*1H |
| InChIKey | ZAWYTMRVZNCKLA-UHFFFAOYSA-N |
| XLogP | 1.43 |
| TPSA | 43.09 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 8 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 248.95 |
| LogP ≤ 5 | 1.43 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze butanamide;dihydrobromide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of butanamide;dihydrobromide?
The IUPAC name of butanamide;dihydrobromide (CID 140988378) is butanamide;dihydrobromide.
What is the SMILES notation for butanamide;dihydrobromide?
The canonical SMILES for butanamide;dihydrobromide is Br.Br.CCCC(N)=O.
What is the InChIKey of butanamide;dihydrobromide?
The InChIKey is ZAWYTMRVZNCKLA-UHFFFAOYSA-N. The full InChI is InChI=1S/C4H9NO.2BrH/c1-2-3-4(5)6;;/h2-3H2,1H3,(H2,5,6);2*1H.
What are the key properties of butanamide;dihydrobromide?
butanamide;dihydrobromide has a molecular weight of 248.95 g/mol, XLogP of 1.43, 2 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for butanamide;dihydrobromide is sourced from PubChem (CID 140988378), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).