About butanediamide;hydrobromide
butanediamide;hydrobromide (PubChem CID 158484059) has the molecular formula C4H9BrN2O2
and a molecular weight of 197.03 g/mol. Its IUPAC name is butanediamide;hydrobromide.
Molecular Properties
| Compound Name | butanediamide;hydrobromide |
| PubChem CID | 158484059 |
| Molecular Formula | C4H9BrN2O2 |
| Molecular Weight | 197.03 g/mol |
| Exact Mass | 195.98 |
| IUPAC Name | butanediamide;hydrobromide |
| SMILES | Br.NC(=O)CCC(N)=O |
| InChI | InChI=1S/C4H8N2O2.BrH/c5-3(7)1-2-4(6)8;/h1-2H2,(H2,5,7)(H2,6,8);1H |
| InChIKey | GAMSPISYDLOWNZ-UHFFFAOYSA-N |
| XLogP | -0.68 |
| TPSA | 86.18 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 9 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 197.03 |
| LogP ≤ 5 | -0.68 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze butanediamide;hydrobromide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of butanediamide;hydrobromide?
The IUPAC name of butanediamide;hydrobromide (CID 158484059) is butanediamide;hydrobromide.
What is the SMILES notation for butanediamide;hydrobromide?
The canonical SMILES for butanediamide;hydrobromide is Br.NC(=O)CCC(N)=O.
What is the InChIKey of butanediamide;hydrobromide?
The InChIKey is GAMSPISYDLOWNZ-UHFFFAOYSA-N. The full InChI is InChI=1S/C4H8N2O2.BrH/c5-3(7)1-2-4(6)8;/h1-2H2,(H2,5,7)(H2,6,8);1H.
What are the key properties of butanediamide;hydrobromide?
butanediamide;hydrobromide has a molecular weight of 197.03 g/mol, XLogP of -0.68, 3 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for butanediamide;hydrobromide is sourced from PubChem (CID 158484059), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).