About dodecanediamide;nonanediamide
dodecanediamide;nonanediamide (PubChem CID 175017820) has the molecular formula C21H42N4O4
and a molecular weight of 414.59 g/mol. Its IUPAC name is dodecanediamide;nonanediamide.
Molecular Properties
| Compound Name | dodecanediamide;nonanediamide |
| PubChem CID | 175017820 |
| Molecular Formula | C21H42N4O4 |
| Molecular Weight | 414.59 g/mol |
| Exact Mass | 414.32 |
| IUPAC Name | dodecanediamide;nonanediamide |
| SMILES | NC(=O)CCCCCCCC(N)=O.NC(=O)CCCCCCCCCCC(N)=O |
| InChI | InChI=1S/C12H24N2O2.C9H18N2O2/c13-11(15)9-7-5-3-1-2-4-6-8-10-12(14)16;10-8(12)6-4-2-1-3-5-7-9(11)13/h1-10H2,(H2,13,15)(H2,14,16);1-7H2,(H2,10,12)(H2,11,13) |
| InChIKey | MJLQMHIZHFWJRU-UHFFFAOYSA-N |
| XLogP | 2.55 |
| TPSA | 172.36 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 19 |
| Heavy Atoms | 29 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 414.59 |
| LogP ≤ 5 | 2.55 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze dodecanediamide;nonanediamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of dodecanediamide;nonanediamide?
The IUPAC name of dodecanediamide;nonanediamide (CID 175017820) is dodecanediamide;nonanediamide.
What is the SMILES notation for dodecanediamide;nonanediamide?
The canonical SMILES for dodecanediamide;nonanediamide is NC(=O)CCCCCCCC(N)=O.NC(=O)CCCCCCCCCCC(N)=O.
What is the InChIKey of dodecanediamide;nonanediamide?
The InChIKey is MJLQMHIZHFWJRU-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H24N2O2.C9H18N2O2/c13-11(15)9-7-5-3-1-2-4-6-8-10-12(14)16;10-8(12)6-4-2-1-3-5-7-9(11)13/h1-10H2,(H2,13,15)(H2,14,16);1-7H2,(H2,10,12)(H2,11,13).
What are the key properties of dodecanediamide;nonanediamide?
dodecanediamide;nonanediamide has a molecular weight of 414.59 g/mol, XLogP of 2.55, 19 rotatable bonds, 4 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for dodecanediamide;nonanediamide is sourced from PubChem (CID 175017820), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).