About 16-aminohexadecanamide
16-aminohexadecanamide (PubChem CID 86033165) has the molecular formula C16H34N2O
and a molecular weight of 270.46 g/mol. Its IUPAC name is 16-aminohexadecanamide.
Molecular Properties
| Compound Name | 16-aminohexadecanamide |
| PubChem CID | 86033165 |
| Molecular Formula | C16H34N2O |
| Molecular Weight | 270.46 g/mol |
| Exact Mass | 270.27 |
| IUPAC Name | 16-aminohexadecanamide |
| SMILES | NCCCCCCCCCCCCCCCC(N)=O |
| InChI | InChI=1S/C16H34N2O/c17-15-13-11-9-7-5-3-1-2-4-6-8-10-12-14-16(18)19/h1-15,17H2,(H2,18,19) |
| InChIKey | SOXZRWUUFGWXON-UHFFFAOYSA-N |
| XLogP | 3.89 |
| TPSA | 69.11 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 270.46 |
| LogP ≤ 5 | 3.89 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze 16-aminohexadecanamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 16-aminohexadecanamide?
The IUPAC name of 16-aminohexadecanamide (CID 86033165) is 16-aminohexadecanamide.
What is the SMILES notation for 16-aminohexadecanamide?
The canonical SMILES for 16-aminohexadecanamide is NCCCCCCCCCCCCCCCC(N)=O.
What is the InChIKey of 16-aminohexadecanamide?
The InChIKey is SOXZRWUUFGWXON-UHFFFAOYSA-N. The full InChI is InChI=1S/C16H34N2O/c17-15-13-11-9-7-5-3-1-2-4-6-8-10-12-14-16(18)19/h1-15,17H2,(H2,18,19).
What are the key properties of 16-aminohexadecanamide?
16-aminohexadecanamide has a molecular weight of 270.46 g/mol, XLogP of 3.89, 15 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 16-aminohexadecanamide is sourced from PubChem (CID 86033165), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).