About 5-aminopentanamide;ethane
5-aminopentanamide;ethane (PubChem CID 145257040) has the molecular formula C7H18N2O
and a molecular weight of 146.23 g/mol. Its IUPAC name is 5-aminopentanamide;ethane.
Molecular Properties
| Compound Name | 5-aminopentanamide;ethane |
| PubChem CID | 145257040 |
| Molecular Formula | C7H18N2O |
| Molecular Weight | 146.23 g/mol |
| Exact Mass | 146.14 |
| IUPAC Name | 5-aminopentanamide;ethane |
| SMILES | CC.NCCCCC(N)=O |
| InChI | InChI=1S/C5H12N2O.C2H6/c6-4-2-1-3-5(7)8;1-2/h1-4,6H2,(H2,7,8);1-2H3 |
| InChIKey | GHXOAKPCGPYJEA-UHFFFAOYSA-N |
| XLogP | 0.63 |
| TPSA | 69.11 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 10 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 146.23 |
| LogP ≤ 5 | 0.63 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze 5-aminopentanamide;ethane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-aminopentanamide;ethane?
The IUPAC name of 5-aminopentanamide;ethane (CID 145257040) is 5-aminopentanamide;ethane.
What is the SMILES notation for 5-aminopentanamide;ethane?
The canonical SMILES for 5-aminopentanamide;ethane is CC.NCCCCC(N)=O.
What is the InChIKey of 5-aminopentanamide;ethane?
The InChIKey is GHXOAKPCGPYJEA-UHFFFAOYSA-N. The full InChI is InChI=1S/C5H12N2O.C2H6/c6-4-2-1-3-5(7)8;1-2/h1-4,6H2,(H2,7,8);1-2H3.
What are the key properties of 5-aminopentanamide;ethane?
5-aminopentanamide;ethane has a molecular weight of 146.23 g/mol, XLogP of 0.63, 4 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 5-aminopentanamide;ethane is sourced from PubChem (CID 145257040), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).