About hexanediamide;methoxymethane
hexanediamide;methoxymethane (PubChem CID 87287786) has the molecular formula C8H18N2O3
and a molecular weight of 190.24 g/mol. Its IUPAC name is hexanediamide;methoxymethane.
Molecular Properties
| Compound Name | hexanediamide;methoxymethane |
| PubChem CID | 87287786 |
| Molecular Formula | C8H18N2O3 |
| Molecular Weight | 190.24 g/mol |
| Exact Mass | 190.13 |
| IUPAC Name | hexanediamide;methoxymethane |
| SMILES | COC.NC(=O)CCCCC(N)=O |
| InChI | InChI=1S/C6H12N2O2.C2H6O/c7-5(9)3-1-2-4-6(8)10;1-3-2/h1-4H2,(H2,7,9)(H2,8,10);1-2H3 |
| InChIKey | ULRWRKDIMJFCNK-UHFFFAOYSA-N |
| XLogP | -0.22 |
| TPSA | 95.41 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 190.24 |
| LogP ≤ 5 | -0.22 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze hexanediamide;methoxymethane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of hexanediamide;methoxymethane?
The IUPAC name of hexanediamide;methoxymethane (CID 87287786) is hexanediamide;methoxymethane.
What is the SMILES notation for hexanediamide;methoxymethane?
The canonical SMILES for hexanediamide;methoxymethane is COC.NC(=O)CCCCC(N)=O.
What is the InChIKey of hexanediamide;methoxymethane?
The InChIKey is ULRWRKDIMJFCNK-UHFFFAOYSA-N. The full InChI is InChI=1S/C6H12N2O2.C2H6O/c7-5(9)3-1-2-4-6(8)10;1-3-2/h1-4H2,(H2,7,9)(H2,8,10);1-2H3.
What are the key properties of hexanediamide;methoxymethane?
hexanediamide;methoxymethane has a molecular weight of 190.24 g/mol, XLogP of -0.22, 5 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for hexanediamide;methoxymethane is sourced from PubChem (CID 87287786), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).