About copper;tridecanediamide
copper;tridecanediamide (PubChem CID 159780260) has the molecular formula C13H26CuN2O2
and a molecular weight of 305.91 g/mol. Its IUPAC name is copper;tridecanediamide.
Molecular Properties
| Compound Name | copper;tridecanediamide |
| PubChem CID | 159780260 |
| Molecular Formula | C13H26CuN2O2 |
| Molecular Weight | 305.91 g/mol |
| Exact Mass | 305.13 |
| IUPAC Name | copper;tridecanediamide |
| SMILES | NC(=O)CCCCCCCCCCCC(N)=O.[Cu] |
| InChI | InChI=1S/C13H26N2O2.Cu/c14-12(16)10-8-6-4-2-1-3-5-7-9-11-13(15)17;/h1-11H2,(H2,14,16)(H2,15,17); |
| InChIKey | NHGOJCUHKJBSCV-UHFFFAOYSA-N |
| XLogP | 2.25 |
| TPSA | 86.18 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 305.91 |
| LogP ≤ 5 | 2.25 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze copper;tridecanediamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of copper;tridecanediamide?
The IUPAC name of copper;tridecanediamide (CID 159780260) is copper;tridecanediamide.
What is the SMILES notation for copper;tridecanediamide?
The canonical SMILES for copper;tridecanediamide is NC(=O)CCCCCCCCCCCC(N)=O.[Cu].
What is the InChIKey of copper;tridecanediamide?
The InChIKey is NHGOJCUHKJBSCV-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H26N2O2.Cu/c14-12(16)10-8-6-4-2-1-3-5-7-9-11-13(15)17;/h1-11H2,(H2,14,16)(H2,15,17);.
What are the key properties of copper;tridecanediamide?
copper;tridecanediamide has a molecular weight of 305.91 g/mol, XLogP of 2.25, 12 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for copper;tridecanediamide is sourced from PubChem (CID 159780260), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).