About hexanediamide;hydrazine
hexanediamide;hydrazine (PubChem CID 160978463) has the molecular formula C6H16N4O2
and a molecular weight of 176.22 g/mol. Its IUPAC name is hexanediamide;hydrazine.
Molecular Properties
| Compound Name | hexanediamide;hydrazine |
| PubChem CID | 160978463 |
| Molecular Formula | C6H16N4O2 |
| Molecular Weight | 176.22 g/mol |
| Exact Mass | 176.13 |
| IUPAC Name | hexanediamide;hydrazine |
| SMILES | NC(=O)CCCCC(N)=O.NN |
| InChI | InChI=1S/C6H12N2O2.H4N2/c7-5(9)3-1-2-4-6(8)10;1-2/h1-4H2,(H2,7,9)(H2,8,10);1-2H2 |
| InChIKey | SZEPQIOGEFUJLP-UHFFFAOYSA-N |
| XLogP | -1.66 |
| TPSA | 138.22 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 176.22 |
| LogP ≤ 5 | -1.66 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze hexanediamide;hydrazine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of hexanediamide;hydrazine?
The IUPAC name of hexanediamide;hydrazine (CID 160978463) is hexanediamide;hydrazine.
What is the SMILES notation for hexanediamide;hydrazine?
The canonical SMILES for hexanediamide;hydrazine is NC(=O)CCCCC(N)=O.NN.
What is the InChIKey of hexanediamide;hydrazine?
The InChIKey is SZEPQIOGEFUJLP-UHFFFAOYSA-N. The full InChI is InChI=1S/C6H12N2O2.H4N2/c7-5(9)3-1-2-4-6(8)10;1-2/h1-4H2,(H2,7,9)(H2,8,10);1-2H2.
What are the key properties of hexanediamide;hydrazine?
hexanediamide;hydrazine has a molecular weight of 176.22 g/mol, XLogP of -1.66, 5 rotatable bonds, 4 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for hexanediamide;hydrazine is sourced from PubChem (CID 160978463), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).