About cyclohexane;hexanediamide
cyclohexane;hexanediamide (PubChem CID 22340258) has the molecular formula C12H24N2O2
and a molecular weight of 228.34 g/mol. Its IUPAC name is cyclohexane;hexanediamide.
Molecular Properties
| Compound Name | cyclohexane;hexanediamide |
| PubChem CID | 22340258 |
| Molecular Formula | C12H24N2O2 |
| Molecular Weight | 228.34 g/mol |
| Exact Mass | 228.18 |
| IUPAC Name | cyclohexane;hexanediamide |
| SMILES | C1CCCCC1.NC(=O)CCCCC(N)=O |
| InChI | InChI=1S/C6H12N2O2.C6H12/c7-5(9)3-1-2-4-6(8)10;1-2-4-6-5-3-1/h1-4H2,(H2,7,9)(H2,8,10);1-6H2 |
| InChIKey | WQTAJNNGZMBQIE-UHFFFAOYSA-N |
| XLogP | 1.86 |
| TPSA | 86.18 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 228.34 |
| LogP ≤ 5 | 1.86 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze cyclohexane;hexanediamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of cyclohexane;hexanediamide?
The IUPAC name of cyclohexane;hexanediamide (CID 22340258) is cyclohexane;hexanediamide.
What is the SMILES notation for cyclohexane;hexanediamide?
The canonical SMILES for cyclohexane;hexanediamide is C1CCCCC1.NC(=O)CCCCC(N)=O.
What is the InChIKey of cyclohexane;hexanediamide?
The InChIKey is WQTAJNNGZMBQIE-UHFFFAOYSA-N. The full InChI is InChI=1S/C6H12N2O2.C6H12/c7-5(9)3-1-2-4-6(8)10;1-2-4-6-5-3-1/h1-4H2,(H2,7,9)(H2,8,10);1-6H2.
What are the key properties of cyclohexane;hexanediamide?
cyclohexane;hexanediamide has a molecular weight of 228.34 g/mol, XLogP of 1.86, 5 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for cyclohexane;hexanediamide is sourced from PubChem (CID 22340258), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).