About cyclohexanamine;hexanediamide;methane
cyclohexanamine;hexanediamide;methane (PubChem CID 175540568) has the molecular formula C13H29N3O2
and a molecular weight of 259.39 g/mol. Its IUPAC name is cyclohexanamine;hexanediamide;methane.
Molecular Properties
| Compound Name | cyclohexanamine;hexanediamide;methane |
| PubChem CID | 175540568 |
| Molecular Formula | C13H29N3O2 |
| Molecular Weight | 259.39 g/mol |
| Exact Mass | 259.23 |
| IUPAC Name | cyclohexanamine;hexanediamide;methane |
| SMILES | C.NC(=O)CCCCC(N)=O.NC1CCCCC1 |
| InChI | InChI=1S/C6H12N2O2.C6H13N.CH4/c7-5(9)3-1-2-4-6(8)10;7-6-4-2-1-3-5-6;/h1-4H2,(H2,7,9)(H2,8,10);6H,1-5,7H2;1H4 |
| InChIKey | KIPQHVMJYBOSIF-UHFFFAOYSA-N |
| XLogP | 1.43 |
| TPSA | 112.20 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 259.39 |
| LogP ≤ 5 | 1.43 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze cyclohexanamine;hexanediamide;methane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of cyclohexanamine;hexanediamide;methane?
The IUPAC name of cyclohexanamine;hexanediamide;methane (CID 175540568) is cyclohexanamine;hexanediamide;methane.
What is the SMILES notation for cyclohexanamine;hexanediamide;methane?
The canonical SMILES for cyclohexanamine;hexanediamide;methane is C.NC(=O)CCCCC(N)=O.NC1CCCCC1.
What is the InChIKey of cyclohexanamine;hexanediamide;methane?
The InChIKey is KIPQHVMJYBOSIF-UHFFFAOYSA-N. The full InChI is InChI=1S/C6H12N2O2.C6H13N.CH4/c7-5(9)3-1-2-4-6(8)10;7-6-4-2-1-3-5-6;/h1-4H2,(H2,7,9)(H2,8,10);6H,1-5,7H2;1H4.
What are the key properties of cyclohexanamine;hexanediamide;methane?
cyclohexanamine;hexanediamide;methane has a molecular weight of 259.39 g/mol, XLogP of 1.43, 5 rotatable bonds, 3 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for cyclohexanamine;hexanediamide;methane is sourced from PubChem (CID 175540568), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).