About 3-cyclohexylpropanamide;ethane;methanamine
3-cyclohexylpropanamide;ethane;methanamine (PubChem CID 178116013) has the molecular formula C12H28N2O
and a molecular weight of 216.37 g/mol. Its IUPAC name is 3-cyclohexylpropanamide;ethane;methanamine.
Molecular Properties
| Compound Name | 3-cyclohexylpropanamide;ethane;methanamine |
| PubChem CID | 178116013 |
| Molecular Formula | C12H28N2O |
| Molecular Weight | 216.37 g/mol |
| Exact Mass | 216.22 |
| IUPAC Name | 3-cyclohexylpropanamide;ethane;methanamine |
| SMILES | CC.CN.NC(=O)CCC1CCCCC1 |
| InChI | InChI=1S/C9H17NO.C2H6.CH5N/c10-9(11)7-6-8-4-2-1-3-5-8;2*1-2/h8H,1-7H2,(H2,10,11);1-2H3;2H2,1H3 |
| InChIKey | PZPCNTHFFZHETK-UHFFFAOYSA-N |
| XLogP | 2.43 |
| TPSA | 69.11 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 216.37 |
| LogP ≤ 5 | 2.43 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 3-cyclohexylpropanamide;ethane;methanamine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-cyclohexylpropanamide;ethane;methanamine?
The IUPAC name of 3-cyclohexylpropanamide;ethane;methanamine (CID 178116013) is 3-cyclohexylpropanamide;ethane;methanamine.
What is the SMILES notation for 3-cyclohexylpropanamide;ethane;methanamine?
The canonical SMILES for 3-cyclohexylpropanamide;ethane;methanamine is CC.CN.NC(=O)CCC1CCCCC1.
What is the InChIKey of 3-cyclohexylpropanamide;ethane;methanamine?
The InChIKey is PZPCNTHFFZHETK-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H17NO.C2H6.CH5N/c10-9(11)7-6-8-4-2-1-3-5-8;2*1-2/h8H,1-7H2,(H2,10,11);1-2H3;2H2,1H3.
What are the key properties of 3-cyclohexylpropanamide;ethane;methanamine?
3-cyclohexylpropanamide;ethane;methanamine has a molecular weight of 216.37 g/mol, XLogP of 2.43, 3 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 3-cyclohexylpropanamide;ethane;methanamine is sourced from PubChem (CID 178116013), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).