About 3-cyclopropylpropanamide
3-cyclopropylpropanamide (PubChem CID 53414720) has the molecular formula C6H11NO
and a molecular weight of 113.16 g/mol. Its IUPAC name is 3-cyclopropylpropanamide.
Molecular Properties
| Compound Name | 3-cyclopropylpropanamide |
| PubChem CID | 53414720 |
| Molecular Formula | C6H11NO |
| Molecular Weight | 113.16 g/mol |
| Exact Mass | 113.08 |
| IUPAC Name | 3-cyclopropylpropanamide |
| SMILES | NC(=O)CCC1CC1 |
| InChI | InChI=1S/C6H11NO/c7-6(8)4-3-5-1-2-5/h5H,1-4H2,(H2,7,8) |
| InChIKey | QQKQVOVFPXDPEM-UHFFFAOYSA-N |
| XLogP | 0.66 |
| TPSA | 43.09 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 8 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 113.16 |
| LogP ≤ 5 | 0.66 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze 3-cyclopropylpropanamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-cyclopropylpropanamide?
The IUPAC name of 3-cyclopropylpropanamide (CID 53414720) is 3-cyclopropylpropanamide.
What is the SMILES notation for 3-cyclopropylpropanamide?
The canonical SMILES for 3-cyclopropylpropanamide is NC(=O)CCC1CC1.
What is the InChIKey of 3-cyclopropylpropanamide?
The InChIKey is QQKQVOVFPXDPEM-UHFFFAOYSA-N. The full InChI is InChI=1S/C6H11NO/c7-6(8)4-3-5-1-2-5/h5H,1-4H2,(H2,7,8).
What are the key properties of 3-cyclopropylpropanamide?
3-cyclopropylpropanamide has a molecular weight of 113.16 g/mol, XLogP of 0.66, 3 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 3-cyclopropylpropanamide is sourced from PubChem (CID 53414720), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).