About 2-aminoethyl 3-cyclopropylpropanoate
2-aminoethyl 3-cyclopropylpropanoate (PubChem CID 174465831) has the molecular formula C8H15NO2
and a molecular weight of 157.21 g/mol. Its IUPAC name is 2-aminoethyl 3-cyclopropylpropanoate.
Molecular Properties
| Compound Name | 2-aminoethyl 3-cyclopropylpropanoate |
| PubChem CID | 174465831 |
| Molecular Formula | C8H15NO2 |
| Molecular Weight | 157.21 g/mol |
| Exact Mass | 157.11 |
| IUPAC Name | 2-aminoethyl 3-cyclopropylpropanoate |
| SMILES | NCCOC(=O)CCC1CC1 |
| InChI | InChI=1S/C8H15NO2/c9-5-6-11-8(10)4-3-7-1-2-7/h7H,1-6,9H2 |
| InChIKey | VYQMQJVVLROZSG-UHFFFAOYSA-N |
| XLogP | 0.68 |
| TPSA | 52.32 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 157.21 |
| LogP ≤ 5 | 0.68 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 2-aminoethyl 3-cyclopropylpropanoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-aminoethyl 3-cyclopropylpropanoate?
The IUPAC name of 2-aminoethyl 3-cyclopropylpropanoate (CID 174465831) is 2-aminoethyl 3-cyclopropylpropanoate.
What is the SMILES notation for 2-aminoethyl 3-cyclopropylpropanoate?
The canonical SMILES for 2-aminoethyl 3-cyclopropylpropanoate is NCCOC(=O)CCC1CC1.
What is the InChIKey of 2-aminoethyl 3-cyclopropylpropanoate?
The InChIKey is VYQMQJVVLROZSG-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H15NO2/c9-5-6-11-8(10)4-3-7-1-2-7/h7H,1-6,9H2.
What are the key properties of 2-aminoethyl 3-cyclopropylpropanoate?
2-aminoethyl 3-cyclopropylpropanoate has a molecular weight of 157.21 g/mol, XLogP of 0.68, 5 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 2-aminoethyl 3-cyclopropylpropanoate is sourced from PubChem (CID 174465831), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).