About [bromo(3-cyclopropylpropanoyloxy)indiganyl] 3-cyclopropylpropanoate
[bromo(3-cyclopropylpropanoyloxy)indiganyl] 3-cyclopropylpropanoate (PubChem CID 144651003) has the molecular formula C12H18BrInO4
and a molecular weight of 420.99 g/mol. Its IUPAC name is [bromo(3-cyclopropylpropanoyloxy)indiganyl] 3-cyclopropylpropanoate.
Molecular Properties
| Compound Name | [bromo(3-cyclopropylpropanoyloxy)indiganyl] 3-cyclopropylpropanoate |
| PubChem CID | 144651003 |
| Molecular Formula | C12H18BrInO4 |
| Molecular Weight | 420.99 g/mol |
| Exact Mass | 419.94 |
| IUPAC Name | [bromo(3-cyclopropylpropanoyloxy)indiganyl] 3-cyclopropylpropanoate |
| SMILES | O=C(CCC1CC1)O[In](Br)OC(=O)CCC1CC1 |
| InChI | InChI=1S/2C6H10O2.BrH.In/c2*7-6(8)4-3-5-1-2-5;;/h2*5H,1-4H2,(H,7,8);1H;/q;;;+3/p-3 |
| InChIKey | BNUJICSULWZOTG-UHFFFAOYSA-K |
| XLogP | 2.83 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 420.99 |
| LogP ≤ 5 | 2.83 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze [bromo(3-cyclopropylpropanoyloxy)indiganyl] 3-cyclopropylpropanoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [bromo(3-cyclopropylpropanoyloxy)indiganyl] 3-cyclopropylpropanoate?
The IUPAC name of [bromo(3-cyclopropylpropanoyloxy)indiganyl] 3-cyclopropylpropanoate (CID 144651003) is [bromo(3-cyclopropylpropanoyloxy)indiganyl] 3-cyclopropylpropanoate.
What is the SMILES notation for [bromo(3-cyclopropylpropanoyloxy)indiganyl] 3-cyclopropylpropanoate?
The canonical SMILES for [bromo(3-cyclopropylpropanoyloxy)indiganyl] 3-cyclopropylpropanoate is O=C(CCC1CC1)O[In](Br)OC(=O)CCC1CC1.
What is the InChIKey of [bromo(3-cyclopropylpropanoyloxy)indiganyl] 3-cyclopropylpropanoate?
The InChIKey is BNUJICSULWZOTG-UHFFFAOYSA-K. The full InChI is InChI=1S/2C6H10O2.BrH.In/c2*7-6(8)4-3-5-1-2-5;;/h2*5H,1-4H2,(H,7,8);1H;/q;;;+3/p-3.
What are the key properties of [bromo(3-cyclopropylpropanoyloxy)indiganyl] 3-cyclopropylpropanoate?
[bromo(3-cyclopropylpropanoyloxy)indiganyl] 3-cyclopropylpropanoate has a molecular weight of 420.99 g/mol, XLogP of 2.83, 8 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for [bromo(3-cyclopropylpropanoyloxy)indiganyl] 3-cyclopropylpropanoate is sourced from PubChem (CID 144651003), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).