About acetyl 3-cyclohexylpropanoate
acetyl 3-cyclohexylpropanoate (PubChem CID 175292524) has the molecular formula C11H18O3
and a molecular weight of 198.26 g/mol. Its IUPAC name is acetyl 3-cyclohexylpropanoate.
Molecular Properties
| Compound Name | acetyl 3-cyclohexylpropanoate |
| PubChem CID | 175292524 |
| Molecular Formula | C11H18O3 |
| Molecular Weight | 198.26 g/mol |
| Exact Mass | 198.13 |
| IUPAC Name | acetyl 3-cyclohexylpropanoate |
| SMILES | CC(=O)OC(=O)CCC1CCCCC1 |
| InChI | InChI=1S/C11H18O3/c1-9(12)14-11(13)8-7-10-5-3-2-4-6-10/h10H,2-8H2,1H3 |
| InChIKey | KNDRRIKDFLLPHV-UHFFFAOYSA-N |
| XLogP | 2.44 |
| TPSA | 43.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 198.26 |
| LogP ≤ 5 | 2.44 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|
Analyze acetyl 3-cyclohexylpropanoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of acetyl 3-cyclohexylpropanoate?
The IUPAC name of acetyl 3-cyclohexylpropanoate (CID 175292524) is acetyl 3-cyclohexylpropanoate.
What is the SMILES notation for acetyl 3-cyclohexylpropanoate?
The canonical SMILES for acetyl 3-cyclohexylpropanoate is CC(=O)OC(=O)CCC1CCCCC1.
What is the InChIKey of acetyl 3-cyclohexylpropanoate?
The InChIKey is KNDRRIKDFLLPHV-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H18O3/c1-9(12)14-11(13)8-7-10-5-3-2-4-6-10/h10H,2-8H2,1H3.
What are the key properties of acetyl 3-cyclohexylpropanoate?
acetyl 3-cyclohexylpropanoate has a molecular weight of 198.26 g/mol, XLogP of 2.44, 3 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for acetyl 3-cyclohexylpropanoate is sourced from PubChem (CID 175292524), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).