C17H32NO2+ — CID 167315003
2-piperidin-1-ium-4-ylpropan-2-yl 3-cyclohexylpropanoate (PubChem CID 167315003) has the molecular formula C17H32NO2+ and a molecular weight of 282.45 g/mol. Its IUPAC name is 2-piperidin-1-ium-4-ylpropan-2-yl 3-cyclohexylpropanoate.
| Compound Name | 2-piperidin-1-ium-4-ylpropan-2-yl 3-cyclohexylpropanoate |
|---|---|
| PubChem CID | 167315003 |
| Molecular Formula | C17H32NO2+ |
| Molecular Weight | 282.45 g/mol |
| Exact Mass | 282.24 |
| IUPAC Name | 2-piperidin-1-ium-4-ylpropan-2-yl 3-cyclohexylpropanoate |
| SMILES | CC(C)(OC(=O)CCC1CCCCC1)C1CC[NH2+]CC1 |
| InChI | InChI=1S/C17H31NO2/c1-17(2,15-10-12-18-13-11-15)20-16(19)9-8-14-6-4-3-5-7-14/h14-15,18H,3-13H2,1-2H3/p+1 |
| InChIKey | HKMOHOCYDBSQFB-UHFFFAOYSA-O |
| XLogP | 2.64 |
| TPSA | 42.91 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 282.45 |
| LogP ≤ 5 | 2.64 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |