C12H24NO2+ — CID 167316100
2-piperidin-1-ium-4-ylpropan-2-yl butanoate (PubChem CID 167316100) has the molecular formula C12H24NO2+ and a molecular weight of 214.33 g/mol. Its IUPAC name is 2-piperidin-1-ium-4-ylpropan-2-yl butanoate.
| Compound Name | 2-piperidin-1-ium-4-ylpropan-2-yl butanoate |
|---|---|
| PubChem CID | 167316100 |
| Molecular Formula | C12H24NO2+ |
| Molecular Weight | 214.33 g/mol |
| Exact Mass | 214.18 |
| IUPAC Name | 2-piperidin-1-ium-4-ylpropan-2-yl butanoate |
| SMILES | CCCC(=O)OC(C)(C)C1CC[NH2+]CC1 |
| InChI | InChI=1S/C12H23NO2/c1-4-5-11(14)15-12(2,3)10-6-8-13-9-7-10/h10,13H,4-9H2,1-3H3/p+1 |
| InChIKey | ZVGBHEDTPMKDEZ-UHFFFAOYSA-O |
| XLogP | 1.08 |
| TPSA | 42.91 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 214.33 |
| LogP ≤ 5 | 1.08 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |