C16H24NO2S+ — CID 167315845
2-piperidin-1-ium-4-ylpropan-2-yl 2-phenylsulfanylacetate (PubChem CID 167315845) has the molecular formula C16H24NO2S+ and a molecular weight of 294.44 g/mol. Its IUPAC name is 2-piperidin-1-ium-4-ylpropan-2-yl 2-phenylsulfanylacetate.
| Compound Name | 2-piperidin-1-ium-4-ylpropan-2-yl 2-phenylsulfanylacetate |
|---|---|
| PubChem CID | 167315845 |
| Molecular Formula | C16H24NO2S+ |
| Molecular Weight | 294.44 g/mol |
| Exact Mass | 294.15 |
| IUPAC Name | 2-piperidin-1-ium-4-ylpropan-2-yl 2-phenylsulfanylacetate |
| SMILES | CC(C)(OC(=O)CSc1ccccc1)C1CC[NH2+]CC1 |
| InChI | InChI=1S/C16H23NO2S/c1-16(2,13-8-10-17-11-9-13)19-15(18)12-20-14-6-4-3-5-7-14/h3-7,13,17H,8-12H2,1-2H3/p+1 |
| InChIKey | BVXUVFCIIFOXHK-UHFFFAOYSA-O |
| XLogP | 2.07 |
| TPSA | 42.91 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 294.44 |
| LogP ≤ 5 | 2.07 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |