About 2-piperidin-1-ium-4-ylpropan-2-yl 4-phenoxybenzoate
2-piperidin-1-ium-4-ylpropan-2-yl 4-phenoxybenzoate (PubChem CID 167315359) has the molecular formula C21H26NO3+
and a molecular weight of 340.44 g/mol. Its IUPAC name is 2-piperidin-1-ium-4-ylpropan-2-yl 4-phenoxybenzoate.
Molecular Properties
| Compound Name | 2-piperidin-1-ium-4-ylpropan-2-yl 4-phenoxybenzoate |
| PubChem CID | 167315359 |
| Molecular Formula | C21H26NO3+ |
| Molecular Weight | 340.44 g/mol |
| Exact Mass | 340.19 |
| IUPAC Name | 2-piperidin-1-ium-4-ylpropan-2-yl 4-phenoxybenzoate |
| SMILES | CC(C)(OC(=O)c1ccc(Oc2ccccc2)cc1)C1CC[NH2+]CC1 |
| InChI | InChI=1S/C21H25NO3/c1-21(2,17-12-14-22-15-13-17)25-20(23)16-8-10-19(11-9-16)24-18-6-4-3-5-7-18/h3-11,17,22H,12-15H2,1-2H3/p+1 |
| InChIKey | WAGFWPOWQCRUMG-UHFFFAOYSA-O |
| XLogP | 3.39 |
| TPSA | 52.14 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 340.44 |
| LogP ≤ 5 | 3.39 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 2-piperidin-1-ium-4-ylpropan-2-yl 4-phenoxybenzoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-piperidin-1-ium-4-ylpropan-2-yl 4-phenoxybenzoate?
The IUPAC name of 2-piperidin-1-ium-4-ylpropan-2-yl 4-phenoxybenzoate (CID 167315359) is 2-piperidin-1-ium-4-ylpropan-2-yl 4-phenoxybenzoate.
What is the SMILES notation for 2-piperidin-1-ium-4-ylpropan-2-yl 4-phenoxybenzoate?
The canonical SMILES for 2-piperidin-1-ium-4-ylpropan-2-yl 4-phenoxybenzoate is CC(C)(OC(=O)c1ccc(Oc2ccccc2)cc1)C1CC[NH2+]CC1.
What is the InChIKey of 2-piperidin-1-ium-4-ylpropan-2-yl 4-phenoxybenzoate?
The InChIKey is WAGFWPOWQCRUMG-UHFFFAOYSA-O. The full InChI is InChI=1S/C21H25NO3/c1-21(2,17-12-14-22-15-13-17)25-20(23)16-8-10-19(11-9-16)24-18-6-4-3-5-7-18/h3-11,17,22H,12-15H2,1-2H3/p+1.
What are the key properties of 2-piperidin-1-ium-4-ylpropan-2-yl 4-phenoxybenzoate?
2-piperidin-1-ium-4-ylpropan-2-yl 4-phenoxybenzoate has a molecular weight of 340.44 g/mol, XLogP of 3.39, 5 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 2-piperidin-1-ium-4-ylpropan-2-yl 4-phenoxybenzoate is sourced from PubChem (CID 167315359), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).