C15H21INO2+ — CID 154609820
2-piperidin-1-ium-4-ylpropan-2-yl 4-iodobenzoate (PubChem CID 154609820) has the molecular formula C15H21INO2+ and a molecular weight of 374.24 g/mol. Its IUPAC name is 2-piperidin-1-ium-4-ylpropan-2-yl 4-iodobenzoate.
| Compound Name | 2-piperidin-1-ium-4-ylpropan-2-yl 4-iodobenzoate |
|---|---|
| PubChem CID | 154609820 |
| Molecular Formula | C15H21INO2+ |
| Molecular Weight | 374.24 g/mol |
| Exact Mass | 374.06 |
| IUPAC Name | 2-piperidin-1-ium-4-ylpropan-2-yl 4-iodobenzoate |
| SMILES | CC(C)(OC(=O)c1ccc(I)cc1)C1CC[NH2+]CC1 |
| InChI | InChI=1S/C15H20INO2/c1-15(2,12-7-9-17-10-8-12)19-14(18)11-3-5-13(16)6-4-11/h3-6,12,17H,7-10H2,1-2H3/p+1 |
| InChIKey | VXQGSNNXIDAXOF-UHFFFAOYSA-O |
| XLogP | 2.20 |
| TPSA | 42.91 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 374.24 |
| LogP ≤ 5 | 2.20 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|