C20H26NO3+ — CID 167315052
2-piperidin-1-ium-4-ylpropan-2-yl 6-methoxynaphthalene-2-carboxylate (PubChem CID 167315052) has the molecular formula C20H26NO3+ and a molecular weight of 328.43 g/mol. Its IUPAC name is 2-piperidin-1-ium-4-ylpropan-2-yl 6-methoxynaphthalene-2-carboxylate.
| Compound Name | 2-piperidin-1-ium-4-ylpropan-2-yl 6-methoxynaphthalene-2-carboxylate |
|---|---|
| PubChem CID | 167315052 |
| Molecular Formula | C20H26NO3+ |
| Molecular Weight | 328.43 g/mol |
| Exact Mass | 328.19 |
| IUPAC Name | 2-piperidin-1-ium-4-ylpropan-2-yl 6-methoxynaphthalene-2-carboxylate |
| SMILES | COc1ccc2cc(C(=O)OC(C)(C)C3CC[NH2+]CC3)ccc2c1 |
| InChI | InChI=1S/C20H25NO3/c1-20(2,17-8-10-21-11-9-17)24-19(22)16-5-4-15-13-18(23-3)7-6-14(15)12-16/h4-7,12-13,17,21H,8-11H2,1-3H3/p+1 |
| InChIKey | OQSYRBKKAHMLOH-UHFFFAOYSA-O |
| XLogP | 2.76 |
| TPSA | 52.14 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 328.43 |
| LogP ≤ 5 | 2.76 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |